Barium iodate

Barium iodate

Identifiers
CAS Number	10567-69-8
ChemSpider	145385
Jmol 3D model	Interactive image
PubChem	165892
InChI InChI=1S/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2 Key: GASILTKHXWGKMG-UHFFFAOYSA-L InChI=1/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2 Key: GASILTKHXWGKMG-NUQVWONBAR
SMILES [Ba+2].[O-]I(=O)=O.[O-]I(=O)=O
Properties
Chemical formula	Ba(IO3)2
Molar mass	505.15 g/mol
Melting point	580 °C (1,076 °F; 853 K)(decomposes)
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Barium iodate is an inorganic chemical compound with the chemical formula Ba(IO₃)₂. It is a white, granular substance.

Derivation

Barium iodate can be derived either as a product of a reaction of iodine and barium hydroxide or by combining barium chlorate with potassium iodate.

Chemical properties

The compound is stable on a temperature up to approximately 580 °C (1,076 °F). If the temperature is higher than that value, the following reaction, known as Rammelsberg's reaction, occurs:

Ba(IO₃)₂ → Ba₅(IO₆)₂ + 9 O₂ + 4 I₂

External links

• Definition of Insoluble salts (precipitates); Solubility product