PD-217,014

PD-217,014

175px
Systematic (IUPAC) name
(1α,3α,5α)-3-aminomethyl-bicyclo[3.2.0]heptane-3-acetic acid
Identifiers
CAS Number	444088-20-4 Y
PubChem	CID: 10313401
ChemSpider	19264101
Chemical data
Formula	C10H17NO2
Molecular mass	183.247 g/mol
SMILES C1C[C@@H]2[C@H]1C[C@](C2)(CC(=O)O)CN
InChI InChI=1S/C10H17NO2/c11-6-10(5-9(12)13)3-7-1-2-8(7)4-10/h7-8H,1-6,11H2,(H,12,13)/t7-,8+,10+ Key:NDDZVQRQVFTNSN-MBTKJCJQSA-N

PD-217,014 is a drug developed by Pfizer and related to gabapentin, which similarly binds to the α₂δ calcium channels (1 and 2). It was developed as a potentially more potent successor to gabapentin and pregabalin, along with several other analogues such as atagabalin and 4-methylpregabalin, but while PD-217,014 produces visceral analgesic effects in animal studies with higher potency and efficacy than gabapentin, it was not developed further for clinical use because of its comparatively more complex synthesis, compared to other related analogues.